C21H24BrClN2O3 — CID 145271683
4-amino-N-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-prop-2-enoxyphenyl]methyl]butanamide (PubChem CID 145271683) has the molecular formula C21H24BrClN2O3 and a molecular weight of 467.79 g/mol. Its IUPAC name is 4-amino-N-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-prop-2-enoxyphenyl]methyl]butanamide.
| Compound Name | 4-amino-N-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-prop-2-enoxyphenyl]methyl]butanamide |
|---|---|
| PubChem CID | 145271683 |
| Molecular Formula | C21H24BrClN2O3 |
| Molecular Weight | 467.79 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | 4-amino-N-[[3-[(2-bromo-4-chlorophenyl)methoxy]-5-prop-2-enoxyphenyl]methyl]butanamide |
| SMILES | C=CCOc1cc(CNC(=O)CCCN)cc(OCc2ccc(Cl)cc2Br)c1 |
| InChI | InChI=1S/C21H24BrClN2O3/c1-2-8-27-18-9-15(13-25-21(26)4-3-7-24)10-19(12-18)28-14-16-5-6-17(23)11-20(16)22/h2,5-6,9-12H,1,3-4,7-8,13-14,24H2,(H,25,26) |
| InChIKey | NYOAWTBNJPTYGD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.79 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|