C24H25BrClN3O3 — CID 135174196
N-[2-(azetidin-3-ylmethylamino)-2-oxoethyl]-3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxybenzamide (PubChem CID 135174196) has the molecular formula C24H25BrClN3O3 and a molecular weight of 518.84 g/mol. Its IUPAC name is N-[2-(azetidin-3-ylmethylamino)-2-oxoethyl]-3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxybenzamide.
| Compound Name | N-[2-(azetidin-3-ylmethylamino)-2-oxoethyl]-3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxybenzamide |
|---|---|
| PubChem CID | 135174196 |
| Molecular Formula | C24H25BrClN3O3 |
| Molecular Weight | 518.84 g/mol |
| Exact Mass | 517.08 |
| IUPAC Name | N-[2-(azetidin-3-ylmethylamino)-2-oxoethyl]-3-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-5-prop-2-enoxybenzamide |
| SMILES | C=CCOc1cc(/C=C/c2ccc(Cl)cc2Br)cc(C(=O)NCC(=O)NCC2CNC2)c1 |
| InChI | InChI=1S/C24H25BrClN3O3/c1-2-7-32-21-9-16(3-4-18-5-6-20(26)11-22(18)25)8-19(10-21)24(31)29-15-23(30)28-14-17-12-27-13-17/h2-6,8-11,17,27H,1,7,12-15H2,(H,28,30)(H,29,31)/b4-3+ |
| InChIKey | GUKWJYZGCJDPQP-ONEGZZNKSA-N |
| XLogP | 3.90 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.84 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|