C27H29BrClN3O3 — CID 149007635
N-[4-(azetidin-3-yl)butyl]-5-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzamide (PubChem CID 149007635) has the molecular formula C27H29BrClN3O3 and a molecular weight of 558.90 g/mol. Its IUPAC name is N-[4-(azetidin-3-yl)butyl]-5-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzamide.
| Compound Name | N-[4-(azetidin-3-yl)butyl]-5-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzamide |
|---|---|
| PubChem CID | 149007635 |
| Molecular Formula | C27H29BrClN3O3 |
| Molecular Weight | 558.90 g/mol |
| Exact Mass | 557.11 |
| IUPAC Name | N-[4-(azetidin-3-yl)butyl]-5-[(E)-2-(2-bromo-4-chlorophenyl)ethenyl]-2-[(5-methyl-1,2-oxazol-3-yl)methoxy]benzamide |
| SMILES | Cc1cc(COc2ccc(/C=C/c3ccc(Cl)cc3Br)cc2C(=O)NCCCCC2CNC2)no1 |
| InChI | InChI=1S/C27H29BrClN3O3/c1-18-12-23(32-35-18)17-34-26-10-6-19(5-7-21-8-9-22(29)14-25(21)28)13-24(26)27(33)31-11-3-2-4-20-15-30-16-20/h5-10,12-14,20,30H,2-4,11,15-17H2,1H3,(H,31,33)/b7-5+ |
| InChIKey | QAWYCAWHZVYRSN-FNORWQNLSA-N |
| XLogP | 6.27 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.90 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|