C17H19BrClNO2 — CID 161032531
3-[3-[5-[(2-bromo-4-chlorophenoxy)methyl]furan-2-yl]propyl]azetidine (PubChem CID 161032531) has the molecular formula C17H19BrClNO2 and a molecular weight of 384.70 g/mol. Its IUPAC name is 3-[3-[5-[(2-bromo-4-chlorophenoxy)methyl]furan-2-yl]propyl]azetidine.
| Compound Name | 3-[3-[5-[(2-bromo-4-chlorophenoxy)methyl]furan-2-yl]propyl]azetidine |
|---|---|
| PubChem CID | 161032531 |
| Molecular Formula | C17H19BrClNO2 |
| Molecular Weight | 384.70 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | 3-[3-[5-[(2-bromo-4-chlorophenoxy)methyl]furan-2-yl]propyl]azetidine |
| SMILES | Clc1ccc(OCc2ccc(CCCC3CNC3)o2)c(Br)c1 |
| InChI | InChI=1S/C17H19BrClNO2/c18-16-8-13(19)4-7-17(16)21-11-15-6-5-14(22-15)3-1-2-12-9-20-10-12/h4-8,12,20H,1-3,9-11H2 |
| InChIKey | TZUSIKKWSGZGGM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 34.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.70 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |