C15H13BrClNO3 — CID 43259997
7-[(2-bromo-4-chlorophenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43259997) has the molecular formula C15H13BrClNO3 and a molecular weight of 370.63 g/mol. Its IUPAC name is 7-[(2-bromo-4-chlorophenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | 7-[(2-bromo-4-chlorophenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43259997 |
| Molecular Formula | C15H13BrClNO3 |
| Molecular Weight | 370.63 g/mol |
| Exact Mass | 368.98 |
| IUPAC Name | 7-[(2-bromo-4-chlorophenoxy)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Nc1cc2c(cc1COc1ccc(Cl)cc1Br)OCCO2 |
| InChI | InChI=1S/C15H13BrClNO3/c16-11-6-10(17)1-2-13(11)21-8-9-5-14-15(7-12(9)18)20-4-3-19-14/h1-2,5-7H,3-4,8,18H2 |
| InChIKey | ZKHLDGAODXJZBW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|