C15H14ClNO3 — CID 65126828
6-[(4-chlorophenyl)methoxy]-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 65126828) has the molecular formula C15H14ClNO3 and a molecular weight of 291.73 g/mol. Its IUPAC name is 6-[(4-chlorophenyl)methoxy]-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-[(4-chlorophenyl)methoxy]-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 65126828 |
| Molecular Formula | C15H14ClNO3 |
| Molecular Weight | 291.73 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 6-[(4-chlorophenyl)methoxy]-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | Nc1cc2c(cc1OCc1ccc(Cl)cc1)OCCO2 |
| InChI | InChI=1S/C15H14ClNO3/c16-11-3-1-10(2-4-11)9-20-13-8-15-14(7-12(13)17)18-5-6-19-15/h1-4,7-8H,5-6,9,17H2 |
| InChIKey | OSFIOTZSBMVTRV-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.73 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|