C11H15NO3 — CID 43247834
6-propoxy-2,3-dihydro-1,4-benzodioxin-7-amine (PubChem CID 43247834) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 6-propoxy-2,3-dihydro-1,4-benzodioxin-7-amine.
| Compound Name | 6-propoxy-2,3-dihydro-1,4-benzodioxin-7-amine |
|---|---|
| PubChem CID | 43247834 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 6-propoxy-2,3-dihydro-1,4-benzodioxin-7-amine |
| SMILES | CCCOc1cc2c(cc1N)OCCO2 |
| InChI | InChI=1S/C11H15NO3/c1-2-3-13-9-7-11-10(6-8(9)12)14-4-5-15-11/h6-7H,2-5,12H2,1H3 |
| InChIKey | PPIPVQYQBUFMAI-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|