C18H28N4O2 — CID 69462115
4-propoxybenzene-1,3-diamine (PubChem CID 69462115) has the molecular formula C18H28N4O2 and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-propoxybenzene-1,3-diamine.
| Compound Name | 4-propoxybenzene-1,3-diamine |
|---|---|
| PubChem CID | 69462115 |
| Molecular Formula | C18H28N4O2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 4-propoxybenzene-1,3-diamine |
| SMILES | CCCOc1ccc(N)cc1N.CCCOc1ccc(N)cc1N |
| InChI | InChI=1S/2C9H14N2O/c2*1-2-5-12-9-4-3-7(10)6-8(9)11/h2*3-4,6H,2,5,10-11H2,1H3 |
| InChIKey | XNIBHZVPWDAKMJ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|