C19H28N4O2 — CID 20551659
4-[6-(2,4-diaminophenoxy)-5-methylhexoxy]benzene-1,3-diamine (PubChem CID 20551659) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 4-[6-(2,4-diaminophenoxy)-5-methylhexoxy]benzene-1,3-diamine.
| Compound Name | 4-[6-(2,4-diaminophenoxy)-5-methylhexoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 20551659 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 4-[6-(2,4-diaminophenoxy)-5-methylhexoxy]benzene-1,3-diamine |
| SMILES | CC(CCCCOc1ccc(N)cc1N)COc1ccc(N)cc1N |
| InChI | InChI=1S/C19H28N4O2/c1-13(12-25-19-8-6-15(21)11-17(19)23)4-2-3-9-24-18-7-5-14(20)10-16(18)22/h5-8,10-11,13H,2-4,9,12,20-23H2,1H3 |
| InChIKey | CXEHRQQIYPSKLS-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|