C16H22N4O2 — CID 20551654
4-[3-(2,4-diaminophenoxy)-2-methylpropoxy]benzene-1,3-diamine (PubChem CID 20551654) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[3-(2,4-diaminophenoxy)-2-methylpropoxy]benzene-1,3-diamine.
| Compound Name | 4-[3-(2,4-diaminophenoxy)-2-methylpropoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 20551654 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[3-(2,4-diaminophenoxy)-2-methylpropoxy]benzene-1,3-diamine |
| SMILES | CC(COc1ccc(N)cc1N)COc1ccc(N)cc1N |
| InChI | InChI=1S/C16H22N4O2/c1-10(8-21-15-4-2-11(17)6-13(15)19)9-22-16-5-3-12(18)7-14(16)20/h2-7,10H,8-9,17-20H2,1H3 |
| InChIKey | WZDFXEDFVRDIFA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|