C15H28ClN3O2 — CID 141054171
[3-(2,4-diaminophenoxy)-2-hydroxypropyl]-triethylazanium chloride (PubChem CID 141054171) has the molecular formula C15H28ClN3O2 and a molecular weight of 317.86 g/mol. Its IUPAC name is [3-(2,4-diaminophenoxy)-2-hydroxypropyl]-triethylazanium chloride.
| Compound Name | [3-(2,4-diaminophenoxy)-2-hydroxypropyl]-triethylazanium chloride |
|---|---|
| PubChem CID | 141054171 |
| Molecular Formula | C15H28ClN3O2 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | [3-(2,4-diaminophenoxy)-2-hydroxypropyl]-triethylazanium chloride |
| SMILES | CC[N+](CC)(CC)CC(O)COc1ccc(N)cc1N.[Cl-] |
| InChI | InChI=1S/C15H28N3O2.ClH/c1-4-18(5-2,6-3)10-13(19)11-20-15-8-7-12(16)9-14(15)17;/h7-9,13,19H,4-6,10-11,16-17H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ZPHXENWBJHIGPV-UHFFFAOYSA-M |
| XLogP | -1.53 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | -1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|