C9H12N2O2 — CID 89154714
(2,4-diaminophenyl) propanoate (PubChem CID 89154714) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is (2,4-diaminophenyl) propanoate.
| Compound Name | (2,4-diaminophenyl) propanoate |
|---|---|
| PubChem CID | 89154714 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | (2,4-diaminophenyl) propanoate |
| SMILES | CCC(=O)Oc1ccc(N)cc1N |
| InChI | InChI=1S/C9H12N2O2/c1-2-9(12)13-8-4-3-6(10)5-7(8)11/h3-5H,2,10-11H2,1H3 |
| InChIKey | IXSFMTKZXYKXIY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|