About (4-aminothiophen-3-yl) propanoate;hydrochloride
(4-aminothiophen-3-yl) propanoate;hydrochloride (PubChem CID 175421894) has the molecular formula C7H10ClNO2S
and a molecular weight of 207.68 g/mol. Its IUPAC name is (4-aminothiophen-3-yl) propanoate;hydrochloride.
Molecular Properties
| Compound Name | (4-aminothiophen-3-yl) propanoate;hydrochloride |
| PubChem CID | 175421894 |
| Molecular Formula | C7H10ClNO2S |
| Molecular Weight | 207.68 g/mol |
| Exact Mass | 207.01 |
| IUPAC Name | (4-aminothiophen-3-yl) propanoate;hydrochloride |
| SMILES | CCC(=O)Oc1cscc1N.Cl |
| InChI | InChI=1S/C7H9NO2S.ClH/c1-2-7(9)10-6-4-11-3-5(6)8;/h3-4H,2,8H2,1H3;1H |
| InChIKey | BGGFQTOFTOKJRL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.68 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-aminothiophen-3-yl) propanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminothiophen-3-yl) propanoate;hydrochloride?
The IUPAC name of (4-aminothiophen-3-yl) propanoate;hydrochloride (CID 175421894) is (4-aminothiophen-3-yl) propanoate;hydrochloride.
What is the SMILES notation for (4-aminothiophen-3-yl) propanoate;hydrochloride?
The canonical SMILES for (4-aminothiophen-3-yl) propanoate;hydrochloride is CCC(=O)Oc1cscc1N.Cl.
What is the InChIKey of (4-aminothiophen-3-yl) propanoate;hydrochloride?
The InChIKey is BGGFQTOFTOKJRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2S.ClH/c1-2-7(9)10-6-4-11-3-5(6)8;/h3-4H,2,8H2,1H3;1H.
What are the key properties of (4-aminothiophen-3-yl) propanoate;hydrochloride?
(4-aminothiophen-3-yl) propanoate;hydrochloride has a molecular weight of 207.68 g/mol, XLogP of 2.07, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminothiophen-3-yl) propanoate;hydrochloride is sourced from PubChem (CID 175421894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).