About (2,4,5-triformyloxyphenyl) propanoate
(2,4,5-triformyloxyphenyl) propanoate (PubChem CID 91451612) has the molecular formula C12H10O8
and a molecular weight of 282.20 g/mol. Its IUPAC name is (2,4,5-triformyloxyphenyl) propanoate.
Molecular Properties
| Compound Name | (2,4,5-triformyloxyphenyl) propanoate |
| PubChem CID | 91451612 |
| Molecular Formula | C12H10O8 |
| Molecular Weight | 282.20 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | (2,4,5-triformyloxyphenyl) propanoate |
| SMILES | CCC(=O)Oc1cc(OC=O)c(OC=O)cc1OC=O |
| InChI | InChI=1S/C12H10O8/c1-2-12(16)20-11-4-9(18-6-14)8(17-5-13)3-10(11)19-7-15/h3-7H,2H2,1H3 |
| InChIKey | IWNOBMAFUPUZTA-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,5-triformyloxyphenyl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,5-triformyloxyphenyl) propanoate?
The IUPAC name of (2,4,5-triformyloxyphenyl) propanoate (CID 91451612) is (2,4,5-triformyloxyphenyl) propanoate.
What is the SMILES notation for (2,4,5-triformyloxyphenyl) propanoate?
The canonical SMILES for (2,4,5-triformyloxyphenyl) propanoate is CCC(=O)Oc1cc(OC=O)c(OC=O)cc1OC=O.
What is the InChIKey of (2,4,5-triformyloxyphenyl) propanoate?
The InChIKey is IWNOBMAFUPUZTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O8/c1-2-12(16)20-11-4-9(18-6-14)8(17-5-13)3-10(11)19-7-15/h3-7H,2H2,1H3.
What are the key properties of (2,4,5-triformyloxyphenyl) propanoate?
(2,4,5-triformyloxyphenyl) propanoate has a molecular weight of 282.20 g/mol, XLogP of 0.61, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,5-triformyloxyphenyl) propanoate is sourced from PubChem (CID 91451612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).