About [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate
[2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate (PubChem CID 91135350) has the molecular formula C16H14O8
and a molecular weight of 334.28 g/mol. Its IUPAC name is [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate.
Molecular Properties
| Compound Name | [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate |
| PubChem CID | 91135350 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate |
| SMILES | O=COc1cc(OC(=O)C2CC2)c(OC(=O)C2CC2)cc1OC=O |
| InChI | InChI=1S/C16H14O8/c17-7-21-11-5-13(23-15(19)9-1-2-9)14(6-12(11)22-8-18)24-16(20)10-3-4-10/h5-10H,1-4H2 |
| InChIKey | INAKZBHYEABMIT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate?
The IUPAC name of [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate (CID 91135350) is [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate.
What is the SMILES notation for [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate?
The canonical SMILES for [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate is O=COc1cc(OC(=O)C2CC2)c(OC(=O)C2CC2)cc1OC=O.
What is the InChIKey of [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate?
The InChIKey is INAKZBHYEABMIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O8/c17-7-21-11-5-13(23-15(19)9-1-2-9)14(6-12(11)22-8-18)24-16(20)10-3-4-10/h5-10H,1-4H2.
What are the key properties of [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate?
[2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate has a molecular weight of 334.28 g/mol, XLogP of 1.39, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate is sourced from PubChem (CID 91135350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).