C16H14O8 — CID 91135350
[2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate (PubChem CID 91135350) has the molecular formula C16H14O8 and a molecular weight of 334.28 g/mol. Its IUPAC name is [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate.
| Compound Name | [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 91135350 |
| Molecular Formula | C16H14O8 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | [2-(cyclopropanecarbonyloxy)-4,5-diformyloxyphenyl] cyclopropanecarboxylate |
| SMILES | O=COc1cc(OC(=O)C2CC2)c(OC(=O)C2CC2)cc1OC=O |
| InChI | InChI=1S/C16H14O8/c17-7-21-11-5-13(23-15(19)9-1-2-9)14(6-12(11)22-8-18)24-16(20)10-3-4-10/h5-10H,1-4H2 |
| InChIKey | INAKZBHYEABMIT-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|