C16H16O8 — CID 91583942
(3,4,5-triformyloxyphenyl) cyclohexanecarboxylate (PubChem CID 91583942) has the molecular formula C16H16O8 and a molecular weight of 336.30 g/mol. Its IUPAC name is (3,4,5-triformyloxyphenyl) cyclohexanecarboxylate.
| Compound Name | (3,4,5-triformyloxyphenyl) cyclohexanecarboxylate |
|---|---|
| PubChem CID | 91583942 |
| Molecular Formula | C16H16O8 |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | (3,4,5-triformyloxyphenyl) cyclohexanecarboxylate |
| SMILES | O=COc1cc(OC(=O)C2CCCCC2)cc(OC=O)c1OC=O |
| InChI | InChI=1S/C16H16O8/c17-8-21-13-6-12(7-14(22-9-18)15(13)23-10-19)24-16(20)11-4-2-1-3-5-11/h6-11H,1-5H2 |
| InChIKey | PHZFLKORPKBFFV-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|