About (3-bromo-5-fluorophenyl) cyclohexanecarboxylate
(3-bromo-5-fluorophenyl) cyclohexanecarboxylate (PubChem CID 137371569) has the molecular formula C13H14BrFO2
and a molecular weight of 301.15 g/mol. Its IUPAC name is (3-bromo-5-fluorophenyl) cyclohexanecarboxylate.
Molecular Properties
| Compound Name | (3-bromo-5-fluorophenyl) cyclohexanecarboxylate |
| PubChem CID | 137371569 |
| Molecular Formula | C13H14BrFO2 |
| Molecular Weight | 301.15 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | (3-bromo-5-fluorophenyl) cyclohexanecarboxylate |
| SMILES | O=C(Oc1cc(F)cc(Br)c1)C1CCCCC1 |
| InChI | InChI=1S/C13H14BrFO2/c14-10-6-11(15)8-12(7-10)17-13(16)9-4-2-1-3-5-9/h6-9H,1-5H2 |
| InChIKey | NRTHUVRJUAMPRK-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.15 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (3-bromo-5-fluorophenyl) cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromo-5-fluorophenyl) cyclohexanecarboxylate?
The IUPAC name of (3-bromo-5-fluorophenyl) cyclohexanecarboxylate (CID 137371569) is (3-bromo-5-fluorophenyl) cyclohexanecarboxylate.
What is the SMILES notation for (3-bromo-5-fluorophenyl) cyclohexanecarboxylate?
The canonical SMILES for (3-bromo-5-fluorophenyl) cyclohexanecarboxylate is O=C(Oc1cc(F)cc(Br)c1)C1CCCCC1.
What is the InChIKey of (3-bromo-5-fluorophenyl) cyclohexanecarboxylate?
The InChIKey is NRTHUVRJUAMPRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14BrFO2/c14-10-6-11(15)8-12(7-10)17-13(16)9-4-2-1-3-5-9/h6-9H,1-5H2.
What are the key properties of (3-bromo-5-fluorophenyl) cyclohexanecarboxylate?
(3-bromo-5-fluorophenyl) cyclohexanecarboxylate has a molecular weight of 301.15 g/mol, XLogP of 4.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromo-5-fluorophenyl) cyclohexanecarboxylate is sourced from PubChem (CID 137371569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).