About (2,4,6-trichlorophenyl) cyclopentanecarboxylate
(2,4,6-trichlorophenyl) cyclopentanecarboxylate (PubChem CID 55335085) has the molecular formula C12H11Cl3O2
and a molecular weight of 293.58 g/mol. Its IUPAC name is (2,4,6-trichlorophenyl) cyclopentanecarboxylate.
Molecular Properties
| Compound Name | (2,4,6-trichlorophenyl) cyclopentanecarboxylate |
| PubChem CID | 55335085 |
| Molecular Formula | C12H11Cl3O2 |
| Molecular Weight | 293.58 g/mol |
| Exact Mass | 291.98 |
| IUPAC Name | (2,4,6-trichlorophenyl) cyclopentanecarboxylate |
| SMILES | O=C(Oc1c(Cl)cc(Cl)cc1Cl)C1CCCC1 |
| InChI | InChI=1S/C12H11Cl3O2/c13-8-5-9(14)11(10(15)6-8)17-12(16)7-3-1-2-4-7/h5-7H,1-4H2 |
| InChIKey | IZVNJNWOPQABHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.58 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2,4,6-trichlorophenyl) cyclopentanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4,6-trichlorophenyl) cyclopentanecarboxylate?
The IUPAC name of (2,4,6-trichlorophenyl) cyclopentanecarboxylate (CID 55335085) is (2,4,6-trichlorophenyl) cyclopentanecarboxylate.
What is the SMILES notation for (2,4,6-trichlorophenyl) cyclopentanecarboxylate?
The canonical SMILES for (2,4,6-trichlorophenyl) cyclopentanecarboxylate is O=C(Oc1c(Cl)cc(Cl)cc1Cl)C1CCCC1.
What is the InChIKey of (2,4,6-trichlorophenyl) cyclopentanecarboxylate?
The InChIKey is IZVNJNWOPQABHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11Cl3O2/c13-8-5-9(14)11(10(15)6-8)17-12(16)7-3-1-2-4-7/h5-7H,1-4H2.
What are the key properties of (2,4,6-trichlorophenyl) cyclopentanecarboxylate?
(2,4,6-trichlorophenyl) cyclopentanecarboxylate has a molecular weight of 293.58 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4,6-trichlorophenyl) cyclopentanecarboxylate is sourced from PubChem (CID 55335085), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).