C21H32O2 — CID 15190815
(2,6-ditert-butyl-4-methylphenyl) cyclopentanecarboxylate (PubChem CID 15190815) has the molecular formula C21H32O2 and a molecular weight of 316.49 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) cyclopentanecarboxylate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) cyclopentanecarboxylate |
|---|---|
| PubChem CID | 15190815 |
| Molecular Formula | C21H32O2 |
| Molecular Weight | 316.49 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) cyclopentanecarboxylate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)C2CCCC2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C21H32O2/c1-14-12-16(20(2,3)4)18(17(13-14)21(5,6)7)23-19(22)15-10-8-9-11-15/h12-13,15H,8-11H2,1-7H3 |
| InChIKey | AOKLFKDPRGBVIM-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|