C32H46O6 — CID 10578045
bis(2,6-ditert-butyl-4-methylphenyl) ethanediperoxoate (PubChem CID 10578045) has the molecular formula C32H46O6 and a molecular weight of 526.71 g/mol. Its IUPAC name is bis(2,6-ditert-butyl-4-methylphenyl) ethanediperoxoate.
| Compound Name | bis(2,6-ditert-butyl-4-methylphenyl) ethanediperoxoate |
|---|---|
| PubChem CID | 10578045 |
| Molecular Formula | C32H46O6 |
| Molecular Weight | 526.71 g/mol |
| Exact Mass | 526.33 |
| IUPAC Name | bis(2,6-ditert-butyl-4-methylphenyl) ethanediperoxoate |
| SMILES | Cc1cc(C(C)(C)C)c(OOC(=O)C(=O)OOc2c(C(C)(C)C)cc(C)cc2C(C)(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C32H46O6/c1-19-15-21(29(3,4)5)25(22(16-19)30(6,7)8)35-37-27(33)28(34)38-36-26-23(31(9,10)11)17-20(2)18-24(26)32(12,13)14/h15-18H,1-14H3 |
| InChIKey | DXCRDLHHWSXSSJ-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.71 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|