C17H23F3O2 — CID 91693698
(2,6-ditert-butyl-4-methylphenyl) 2,2,2-trifluoroacetate (PubChem CID 91693698) has the molecular formula C17H23F3O2 and a molecular weight of 316.36 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2,2,2-trifluoroacetate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 91693698 |
| Molecular Formula | C17H23F3O2 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2,2,2-trifluoroacetate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)C(F)(F)F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C17H23F3O2/c1-10-8-11(15(2,3)4)13(12(9-10)16(5,6)7)22-14(21)17(18,19)20/h8-9H,1-7H3 |
| InChIKey | VSJQDSXHHPGWSO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|