C20H32O4 — CID 11313698
(2,6-ditert-butyl-4-methylphenyl) (2R)-2-(methoxymethoxy)propanoate (PubChem CID 11313698) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) (2R)-2-(methoxymethoxy)propanoate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) (2R)-2-(methoxymethoxy)propanoate |
|---|---|
| PubChem CID | 11313698 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) (2R)-2-(methoxymethoxy)propanoate |
| SMILES | COCO[C@H](C)C(=O)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C20H32O4/c1-13-10-15(19(3,4)5)17(16(11-13)20(6,7)8)24-18(21)14(2)23-12-22-9/h10-11,14H,12H2,1-9H3/t14-/m1/s1 |
| InChIKey | APBWOMNVSRODPY-CQSZACIVSA-N |
| XLogP | 4.50 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|