C24H31BrO2 — CID 135080081
(2,6-ditert-butyl-4-methylphenyl) 2-bromo-3-phenylpropanoate (PubChem CID 135080081) has the molecular formula C24H31BrO2 and a molecular weight of 431.41 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) 2-bromo-3-phenylpropanoate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) 2-bromo-3-phenylpropanoate |
|---|---|
| PubChem CID | 135080081 |
| Molecular Formula | C24H31BrO2 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 430.15 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) 2-bromo-3-phenylpropanoate |
| SMILES | Cc1cc(C(C)(C)C)c(OC(=O)C(Br)Cc2ccccc2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C24H31BrO2/c1-16-13-18(23(2,3)4)21(19(14-16)24(5,6)7)27-22(26)20(25)15-17-11-9-8-10-12-17/h8-14,20H,15H2,1-7H3 |
| InChIKey | KHUXABGQEKOIBE-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|