C28H38O2 — CID 134884735
(2,6-ditert-butyl-4-methylphenyl) (2Z)-2-benzylidenehexanoate (PubChem CID 134884735) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenyl) (2Z)-2-benzylidenehexanoate.
| Compound Name | (2,6-ditert-butyl-4-methylphenyl) (2Z)-2-benzylidenehexanoate |
|---|---|
| PubChem CID | 134884735 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenyl) (2Z)-2-benzylidenehexanoate |
| SMILES | CCCC/C(=C/c1ccccc1)C(=O)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C28H38O2/c1-9-10-16-22(19-21-14-12-11-13-15-21)26(29)30-25-23(27(3,4)5)17-20(2)18-24(25)28(6,7)8/h11-15,17-19H,9-10,16H2,1-8H3/b22-19- |
| InChIKey | JPPZTUBVZNWJLN-QOCHGBHMSA-N |
| XLogP | 7.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|