C21H32O4 — CID 18955837
3,5-ditert-butyl-4-hexanoyloxybenzoic acid (PubChem CID 18955837) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is 3,5-ditert-butyl-4-hexanoyloxybenzoic acid.
| Compound Name | 3,5-ditert-butyl-4-hexanoyloxybenzoic acid |
|---|---|
| PubChem CID | 18955837 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | 3,5-ditert-butyl-4-hexanoyloxybenzoic acid |
| SMILES | CCCCCC(=O)Oc1c(C(C)(C)C)cc(C(=O)O)cc1C(C)(C)C |
| InChI | InChI=1S/C21H32O4/c1-8-9-10-11-17(22)25-18-15(20(2,3)4)12-14(19(23)24)13-16(18)21(5,6)7/h12-13H,8-11H2,1-7H3,(H,23,24) |
| InChIKey | JSSZBUWHYSABIY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|