C22H36O3 — CID 90808029
(3,5-ditert-butyl-4-hydroxyphenyl) octanoate (PubChem CID 90808029) has the molecular formula C22H36O3 and a molecular weight of 348.53 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) octanoate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) octanoate |
|---|---|
| PubChem CID | 90808029 |
| Molecular Formula | C22H36O3 |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.27 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) octanoate |
| SMILES | CCCCCCCC(=O)Oc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H36O3/c1-8-9-10-11-12-13-19(23)25-16-14-17(21(2,3)4)20(24)18(15-16)22(5,6)7/h14-15,24H,8-13H2,1-7H3 |
| InChIKey | RAXTXLLXGDIQKL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|