C59H86O6 — CID 87998164
(3,5-ditert-butyl-4-hydroxyphenyl) 3,3,3-tris(3,5-ditert-butyl-4-hydroxyphenyl)propanoate (PubChem CID 87998164) has the molecular formula C59H86O6 and a molecular weight of 891.33 g/mol. Its IUPAC name is (3,5-ditert-butyl-4-hydroxyphenyl) 3,3,3-tris(3,5-ditert-butyl-4-hydroxyphenyl)propanoate.
| Compound Name | (3,5-ditert-butyl-4-hydroxyphenyl) 3,3,3-tris(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
|---|---|
| PubChem CID | 87998164 |
| Molecular Formula | C59H86O6 |
| Molecular Weight | 891.33 g/mol |
| Exact Mass | 890.64 |
| IUPAC Name | (3,5-ditert-butyl-4-hydroxyphenyl) 3,3,3-tris(3,5-ditert-butyl-4-hydroxyphenyl)propanoate |
| SMILES | CC(C)(C)c1cc(OC(=O)CC(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)(c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)cc(C(C)(C)C)c1O |
| InChI | InChI=1S/C59H86O6/c1-51(2,3)38-25-34(26-39(47(38)61)52(4,5)6)59(35-27-40(53(7,8)9)48(62)41(28-35)54(10,11)12,36-29-42(55(13,14)15)49(63)43(30-36)56(16,17)18)33-46(60)65-37-31-44(57(19,20)21)50(64)45(32-37)58(22,23)24/h25-32,61-64H,33H2,1-24H3 |
| InChIKey | KBKQUCFOFVUACU-UHFFFAOYSA-N |
| XLogP | 15.22 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 891.33 |
| LogP ≤ 5 | 15.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|