C30H44O3 — CID 14832985
(2,4-ditert-butylphenyl) 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate (PubChem CID 14832985) has the molecular formula C30H44O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate.
| Compound Name | (2,4-ditert-butylphenyl) 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
|---|---|
| PubChem CID | 14832985 |
| Molecular Formula | C30H44O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.33 |
| IUPAC Name | (2,4-ditert-butylphenyl) 2-(3,5-ditert-butyl-4-hydroxyphenyl)acetate |
| SMILES | CC(C)(C)c1ccc(OC(=O)Cc2cc(C(C)(C)C)c(O)c(C(C)(C)C)c2)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C30H44O3/c1-27(2,3)20-13-14-24(21(18-20)28(4,5)6)33-25(31)17-19-15-22(29(7,8)9)26(32)23(16-19)30(10,11)12/h13-16,18,32H,17H2,1-12H3 |
| InChIKey | SFZAXSDYUUCMGR-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|