C25H30Br2O4 — CID 139838812
[2-tert-butyl-4-[2-(3-tert-butyl-4-carbonobromidoyloxyphenyl)propan-2-yl]phenyl] carbonobromidate (PubChem CID 139838812) has the molecular formula C25H30Br2O4 and a molecular weight of 554.32 g/mol. Its IUPAC name is [2-tert-butyl-4-[2-(3-tert-butyl-4-carbonobromidoyloxyphenyl)propan-2-yl]phenyl] carbonobromidate.
| Compound Name | [2-tert-butyl-4-[2-(3-tert-butyl-4-carbonobromidoyloxyphenyl)propan-2-yl]phenyl] carbonobromidate |
|---|---|
| PubChem CID | 139838812 |
| Molecular Formula | C25H30Br2O4 |
| Molecular Weight | 554.32 g/mol |
| Exact Mass | 552.05 |
| IUPAC Name | [2-tert-butyl-4-[2-(3-tert-butyl-4-carbonobromidoyloxyphenyl)propan-2-yl]phenyl] carbonobromidate |
| SMILES | CC(C)(C)c1cc(C(C)(C)c2ccc(OC(=O)Br)c(C(C)(C)C)c2)ccc1OC(=O)Br |
| InChI | InChI=1S/C25H30Br2O4/c1-23(2,3)17-13-15(9-11-19(17)30-21(26)28)25(7,8)16-10-12-20(31-22(27)29)18(14-16)24(4,5)6/h9-14H,1-8H3 |
| InChIKey | BTWTXFHLBJBQEH-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.32 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|