C19H28O3 — CID 84820548
(2,4-ditert-butylphenyl) (E)-3-ethoxyprop-2-enoate (PubChem CID 84820548) has the molecular formula C19H28O3 and a molecular weight of 304.43 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) (E)-3-ethoxyprop-2-enoate.
| Compound Name | (2,4-ditert-butylphenyl) (E)-3-ethoxyprop-2-enoate |
|---|---|
| PubChem CID | 84820548 |
| Molecular Formula | C19H28O3 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.20 |
| IUPAC Name | (2,4-ditert-butylphenyl) (E)-3-ethoxyprop-2-enoate |
| SMILES | CCO/C=C/C(=O)Oc1ccc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C19H28O3/c1-8-21-12-11-17(20)22-16-10-9-14(18(2,3)4)13-15(16)19(5,6)7/h9-13H,8H2,1-7H3/b12-11+ |
| InChIKey | NPVDQOXUQHEAQE-VAWYXSNFSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|