C29H42O2 — CID 15501021
(2,4-ditert-butylphenyl) 3,5-ditert-butylbenzoate (PubChem CID 15501021) has the molecular formula C29H42O2 and a molecular weight of 422.65 g/mol. Its IUPAC name is (2,4-ditert-butylphenyl) 3,5-ditert-butylbenzoate.
| Compound Name | (2,4-ditert-butylphenyl) 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 15501021 |
| Molecular Formula | C29H42O2 |
| Molecular Weight | 422.65 g/mol |
| Exact Mass | 422.32 |
| IUPAC Name | (2,4-ditert-butylphenyl) 3,5-ditert-butylbenzoate |
| SMILES | CC(C)(C)c1cc(C(=O)Oc2ccc(C(C)(C)C)cc2C(C)(C)C)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C29H42O2/c1-26(2,3)20-13-14-24(23(18-20)29(10,11)12)31-25(30)19-15-21(27(4,5)6)17-22(16-19)28(7,8)9/h13-18H,1-12H3 |
| InChIKey | LKEYZHPETJJAQI-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|