C31H46O2 — CID 57060342
[2,4-bis(2-methylbutan-2-yl)phenyl] 3,5-ditert-butylbenzoate (PubChem CID 57060342) has the molecular formula C31H46O2 and a molecular weight of 450.71 g/mol. Its IUPAC name is [2,4-bis(2-methylbutan-2-yl)phenyl] 3,5-ditert-butylbenzoate.
| Compound Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3,5-ditert-butylbenzoate |
|---|---|
| PubChem CID | 57060342 |
| Molecular Formula | C31H46O2 |
| Molecular Weight | 450.71 g/mol |
| Exact Mass | 450.35 |
| IUPAC Name | [2,4-bis(2-methylbutan-2-yl)phenyl] 3,5-ditert-butylbenzoate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C31H46O2/c1-13-30(9,10)22-15-16-26(25(20-22)31(11,12)14-2)33-27(32)21-17-23(28(3,4)5)19-24(18-21)29(6,7)8/h15-20H,13-14H2,1-12H3 |
| InChIKey | KBFIVBQLSCGNBI-UHFFFAOYSA-N |
| XLogP | 8.88 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.71 |
| LogP ≤ 5 | 8.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|