C35H44O4 — CID 21340048
1-O-[2,4-bis(2-methylbutan-2-yl)phenyl] 2-O-[2-(2-methylbutan-2-yl)phenyl] benzene-1,2-dicarboxylate (PubChem CID 21340048) has the molecular formula C35H44O4 and a molecular weight of 528.73 g/mol. Its IUPAC name is 1-O-[2,4-bis(2-methylbutan-2-yl)phenyl] 2-O-[2-(2-methylbutan-2-yl)phenyl] benzene-1,2-dicarboxylate.
| Compound Name | 1-O-[2,4-bis(2-methylbutan-2-yl)phenyl] 2-O-[2-(2-methylbutan-2-yl)phenyl] benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 21340048 |
| Molecular Formula | C35H44O4 |
| Molecular Weight | 528.73 g/mol |
| Exact Mass | 528.32 |
| IUPAC Name | 1-O-[2,4-bis(2-methylbutan-2-yl)phenyl] 2-O-[2-(2-methylbutan-2-yl)phenyl] benzene-1,2-dicarboxylate |
| SMILES | CCC(C)(C)c1ccc(OC(=O)c2ccccc2C(=O)Oc2ccccc2C(C)(C)CC)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H44O4/c1-10-33(4,5)24-21-22-30(28(23-24)35(8,9)12-3)39-32(37)26-18-14-13-17-25(26)31(36)38-29-20-16-15-19-27(29)34(6,7)11-2/h13-23H,10-12H2,1-9H3 |
| InChIKey | JDEOJGRGRSXQJP-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.73 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|