C17H27NO — CID 91508673
2,4-bis(2-methylbutan-2-yl)benzamide (PubChem CID 91508673) has the molecular formula C17H27NO and a molecular weight of 261.41 g/mol. Its IUPAC name is 2,4-bis(2-methylbutan-2-yl)benzamide.
| Compound Name | 2,4-bis(2-methylbutan-2-yl)benzamide |
|---|---|
| PubChem CID | 91508673 |
| Molecular Formula | C17H27NO |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.21 |
| IUPAC Name | 2,4-bis(2-methylbutan-2-yl)benzamide |
| SMILES | CCC(C)(C)c1ccc(C(N)=O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C17H27NO/c1-7-16(3,4)12-9-10-13(15(18)19)14(11-12)17(5,6)8-2/h9-11H,7-8H2,1-6H3,(H2,18,19) |
| InChIKey | YWXWICFYEBIYBM-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |