C20H34O2 — CID 163614465
3-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-2-ol (PubChem CID 163614465) has the molecular formula C20H34O2 and a molecular weight of 306.49 g/mol. Its IUPAC name is 3-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-2-ol.
| Compound Name | 3-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-2-ol |
|---|---|
| PubChem CID | 163614465 |
| Molecular Formula | C20H34O2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.26 |
| IUPAC Name | 3-[2,4-bis(2-methylbutan-2-yl)phenoxy]butan-2-ol |
| SMILES | CCC(C)(C)c1ccc(OC(C)C(C)O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C20H34O2/c1-9-19(5,6)16-11-12-18(22-15(4)14(3)21)17(13-16)20(7,8)10-2/h11-15,21H,9-10H2,1-8H3 |
| InChIKey | HITZICWGOPZIOP-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |