C16H26FO3P — CID 70237708
[2,4-bis(2-methylbutan-2-yl)phenyl] fluoro hydrogen phosphite (PubChem CID 70237708) has the molecular formula C16H26FO3P and a molecular weight of 316.35 g/mol. Its IUPAC name is [2,4-bis(2-methylbutan-2-yl)phenyl] fluoro hydrogen phosphite.
| Compound Name | [2,4-bis(2-methylbutan-2-yl)phenyl] fluoro hydrogen phosphite |
|---|---|
| PubChem CID | 70237708 |
| Molecular Formula | C16H26FO3P |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | [2,4-bis(2-methylbutan-2-yl)phenyl] fluoro hydrogen phosphite |
| SMILES | CCC(C)(C)c1ccc(OP(O)OF)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C16H26FO3P/c1-7-15(3,4)12-9-10-14(19-21(18)20-17)13(11-12)16(5,6)8-2/h9-11,18H,7-8H2,1-6H3 |
| InChIKey | IZJLRPMHUPCEQK-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|