C16H27O3P — CID 19899887
[2,4-bis(2-methylbutan-2-yl)phenyl] dihydrogen phosphite (PubChem CID 19899887) has the molecular formula C16H27O3P and a molecular weight of 298.36 g/mol. Its IUPAC name is [2,4-bis(2-methylbutan-2-yl)phenyl] dihydrogen phosphite.
| Compound Name | [2,4-bis(2-methylbutan-2-yl)phenyl] dihydrogen phosphite |
|---|---|
| PubChem CID | 19899887 |
| Molecular Formula | C16H27O3P |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | [2,4-bis(2-methylbutan-2-yl)phenyl] dihydrogen phosphite |
| SMILES | CCC(C)(C)c1ccc(OP(O)O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C16H27O3P/c1-7-15(3,4)12-9-10-14(19-20(17)18)13(11-12)16(5,6)8-2/h9-11,17-18H,7-8H2,1-6H3 |
| InChIKey | AJALGFIICGEQEI-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|