C17H28 — CID 20667880
1-methyl-2,4-bis(2-methylbutan-2-yl)benzene (PubChem CID 20667880) has the molecular formula C17H28 and a molecular weight of 232.41 g/mol. Its IUPAC name is 1-methyl-2,4-bis(2-methylbutan-2-yl)benzene.
| Compound Name | 1-methyl-2,4-bis(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 20667880 |
| Molecular Formula | C17H28 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.22 |
| IUPAC Name | 1-methyl-2,4-bis(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(C)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C17H28/c1-8-16(4,5)14-11-10-13(3)15(12-14)17(6,7)9-2/h10-12H,8-9H2,1-7H3 |
| InChIKey | SIQCKLMQXPNZGD-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |