C38H58O — CID 70525545
1-[3-[3-[2,4-bis(2-methylbutan-2-yl)phenyl]prop-2-enoxy]prop-1-enyl]-2,4-bis(2-methylbutan-2-yl)benzene (PubChem CID 70525545) has the molecular formula C38H58O and a molecular weight of 530.88 g/mol. Its IUPAC name is 1-[3-[3-[2,4-bis(2-methylbutan-2-yl)phenyl]prop-2-enoxy]prop-1-enyl]-2,4-bis(2-methylbutan-2-yl)benzene.
| Compound Name | 1-[3-[3-[2,4-bis(2-methylbutan-2-yl)phenyl]prop-2-enoxy]prop-1-enyl]-2,4-bis(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 70525545 |
| Molecular Formula | C38H58O |
| Molecular Weight | 530.88 g/mol |
| Exact Mass | 530.45 |
| IUPAC Name | 1-[3-[3-[2,4-bis(2-methylbutan-2-yl)phenyl]prop-2-enoxy]prop-1-enyl]-2,4-bis(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(C=CCOCC=Cc2ccc(C(C)(C)CC)cc2C(C)(C)CC)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C38H58O/c1-13-35(5,6)31-23-21-29(33(27-31)37(9,10)15-3)19-17-25-39-26-18-20-30-22-24-32(36(7,8)14-2)28-34(30)38(11,12)16-4/h17-24,27-28H,13-16,25-26H2,1-12H3 |
| InChIKey | HDNZMCNVVDKOBV-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.88 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|