C21H36O2 — CID 145479204
1-(4-methoxybutoxy)-2,4-bis(2-methylbutan-2-yl)benzene (PubChem CID 145479204) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-(4-methoxybutoxy)-2,4-bis(2-methylbutan-2-yl)benzene.
| Compound Name | 1-(4-methoxybutoxy)-2,4-bis(2-methylbutan-2-yl)benzene |
|---|---|
| PubChem CID | 145479204 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | 1-(4-methoxybutoxy)-2,4-bis(2-methylbutan-2-yl)benzene |
| SMILES | CCC(C)(C)c1ccc(OCCCCOC)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C21H36O2/c1-8-20(3,4)17-12-13-19(23-15-11-10-14-22-7)18(16-17)21(5,6)9-2/h12-13,16H,8-11,14-15H2,1-7H3 |
| InChIKey | LUZMGOAFNZYWKD-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|