C27H42N2O4S — CID 4191630
3-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-methoxybenzenesulfonamide (PubChem CID 4191630) has the molecular formula C27H42N2O4S and a molecular weight of 490.71 g/mol. Its IUPAC name is 3-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 4191630 |
| Molecular Formula | C27H42N2O4S |
| Molecular Weight | 490.71 g/mol |
| Exact Mass | 490.29 |
| IUPAC Name | 3-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-4-methoxybenzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNS(=O)(=O)c2ccc(OC)c(N)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C27H42N2O4S/c1-8-26(3,4)20-12-14-24(22(18-20)27(5,6)9-2)33-17-11-10-16-29-34(30,31)21-13-15-25(32-7)23(28)19-21/h12-15,18-19,29H,8-11,16-17,28H2,1-7H3 |
| InChIKey | DEYOXGCSSCPJIS-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.71 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|