C20H34O4S — CID 170848277
4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butane-1-sulfonic acid (PubChem CID 170848277) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butane-1-sulfonic acid.
| Compound Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 170848277 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | 4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butane-1-sulfonic acid |
| SMILES | CCC(C)(C)c1ccc(OCCCCS(=O)(=O)O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C20H34O4S/c1-7-19(3,4)16-11-12-18(17(15-16)20(5,6)8-2)24-13-9-10-14-25(21,22)23/h11-12,15H,7-10,13-14H2,1-6H3,(H,21,22,23) |
| InChIKey | FRAPTVIASJSGNW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|