C47H70N2O4 — CID 22952679
1-N,3-N-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5-methylbenzene-1,3-dicarboxamide (PubChem CID 22952679) has the molecular formula C47H70N2O4 and a molecular weight of 727.09 g/mol. Its IUPAC name is 1-N,3-N-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5-methylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5-methylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 22952679 |
| Molecular Formula | C47H70N2O4 |
| Molecular Weight | 727.09 g/mol |
| Exact Mass | 726.53 |
| IUPAC Name | 1-N,3-N-bis[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-5-methylbenzene-1,3-dicarboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2cc(C)cc(C(=O)NCCCOc3ccc(C(C)(C)CC)cc3C(C)(C)CC)c2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C47H70N2O4/c1-14-44(6,7)36-20-22-40(38(31-36)46(10,11)16-3)52-26-18-24-48-42(50)34-28-33(5)29-35(30-34)43(51)49-25-19-27-53-41-23-21-37(45(8,9)15-2)32-39(41)47(12,13)17-4/h20-23,28-32H,14-19,24-27H2,1-13H3,(H,48,50)(H,49,51) |
| InChIKey | ZXJWJHYREPVVLJ-UHFFFAOYSA-N |
| XLogP | 11.14 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.09 |
| LogP ≤ 5 | 11.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|