C26H46N2O2 — CID 7297103
(2S,3R)-2-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide (PubChem CID 7297103) has the molecular formula C26H46N2O2 and a molecular weight of 418.67 g/mol. Its IUPAC name is (2S,3R)-2-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide.
| Compound Name | (2S,3R)-2-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide |
|---|---|
| PubChem CID | 7297103 |
| Molecular Formula | C26H46N2O2 |
| Molecular Weight | 418.67 g/mol |
| Exact Mass | 418.36 |
| IUPAC Name | (2S,3R)-2-amino-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-3-methylpentanamide |
| SMILES | CC[C@@H](C)[C@H](N)C(=O)NCCCCOc1ccc(C(C)(C)CC)cc1C(C)(C)CC |
| InChI | InChI=1S/C26H46N2O2/c1-9-19(4)23(27)24(29)28-16-12-13-17-30-22-15-14-20(25(5,6)10-2)18-21(22)26(7,8)11-3/h14-15,18-19,23H,9-13,16-17,27H2,1-8H3,(H,28,29)/t19-,23+/m1/s1 |
| InChIKey | YNZQPRBEONWHMZ-XXBNENTESA-N |
| XLogP | 5.71 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.67 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|