C28H45N3O2S — CID 3856238
2-(1-aminobutyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide (PubChem CID 3856238) has the molecular formula C28H45N3O2S and a molecular weight of 487.75 g/mol. Its IUPAC name is 2-(1-aminobutyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-aminobutyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3856238 |
| Molecular Formula | C28H45N3O2S |
| Molecular Weight | 487.75 g/mol |
| Exact Mass | 487.32 |
| IUPAC Name | 2-(1-aminobutyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCCC(N)c1nc(C(=O)NCCCCOc2ccc(C(C)(C)CC)cc2C(C)(C)CC)cs1 |
| InChI | InChI=1S/C28H45N3O2S/c1-8-13-22(29)26-31-23(19-34-26)25(32)30-16-11-12-17-33-24-15-14-20(27(4,5)9-2)18-21(24)28(6,7)10-3/h14-15,18-19,22H,8-13,16-17,29H2,1-7H3,(H,30,32) |
| InChIKey | YYWFGXBLMHFLEB-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.75 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|