C28H45N3O2S2 — CID 3856239
2-(1-amino-3-methylsulfanylpropyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide (PubChem CID 3856239) has the molecular formula C28H45N3O2S2 and a molecular weight of 519.82 g/mol. Its IUPAC name is 2-(1-amino-3-methylsulfanylpropyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide.
| Compound Name | 2-(1-amino-3-methylsulfanylpropyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 3856239 |
| Molecular Formula | C28H45N3O2S2 |
| Molecular Weight | 519.82 g/mol |
| Exact Mass | 519.30 |
| IUPAC Name | 2-(1-amino-3-methylsulfanylpropyl)-N-[4-[2,4-bis(2-methylbutan-2-yl)phenoxy]butyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCC(C)(C)c1ccc(OCCCCNC(=O)c2csc(C(N)CCSC)n2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C28H45N3O2S2/c1-8-27(3,4)20-12-13-24(21(18-20)28(5,6)9-2)33-16-11-10-15-30-25(32)23-19-35-26(31-23)22(29)14-17-34-7/h12-13,18-19,22H,8-11,14-17,29H2,1-7H3,(H,30,32) |
| InChIKey | XLZPPJZLGCFANE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.82 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|