C35H41N3O2S2 — CID 20657484
4-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyl-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide (PubChem CID 20657484) has the molecular formula C35H41N3O2S2 and a molecular weight of 599.87 g/mol. Its IUPAC name is 4-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyl-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide.
| Compound Name | 4-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyl-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide |
|---|---|
| PubChem CID | 20657484 |
| Molecular Formula | C35H41N3O2S2 |
| Molecular Weight | 599.87 g/mol |
| Exact Mass | 599.26 |
| IUPAC Name | 4-[1,3-benzothiazol-2-yl(cyano)methyl]sulfanyl-N-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]benzamide |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)c2ccc(SC(C#N)c3nc4ccccc4s3)cc2)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C35H41N3O2S2/c1-7-34(3,4)25-16-19-29(27(22-25)35(5,6)8-2)40-21-11-20-37-32(39)24-14-17-26(18-15-24)41-31(23-36)33-38-28-12-9-10-13-30(28)42-33/h9-10,12-19,22,31H,7-8,11,20-21H2,1-6H3,(H,37,39) |
| InChIKey | ISEYHJBRCIHWCA-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 75.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.87 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|