C26H38N2O4 — CID 20615731
1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-(2,5-dihydroxyphenyl)urea (PubChem CID 20615731) has the molecular formula C26H38N2O4 and a molecular weight of 442.60 g/mol. Its IUPAC name is 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-(2,5-dihydroxyphenyl)urea.
| Compound Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-(2,5-dihydroxyphenyl)urea |
|---|---|
| PubChem CID | 20615731 |
| Molecular Formula | C26H38N2O4 |
| Molecular Weight | 442.60 g/mol |
| Exact Mass | 442.28 |
| IUPAC Name | 1-[3-[2,4-bis(2-methylbutan-2-yl)phenoxy]propyl]-3-(2,5-dihydroxyphenyl)urea |
| SMILES | CCC(C)(C)c1ccc(OCCCNC(=O)Nc2cc(O)ccc2O)c(C(C)(C)CC)c1 |
| InChI | InChI=1S/C26H38N2O4/c1-7-25(3,4)18-10-13-23(20(16-18)26(5,6)8-2)32-15-9-14-27-24(31)28-21-17-19(29)11-12-22(21)30/h10-13,16-17,29-30H,7-9,14-15H2,1-6H3,(H2,27,28,31) |
| InChIKey | CPYDUEVDBQLCAB-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.60 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|