C31H45FN2O4 — CID 101292275
N-[2-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-hydroxyphenyl]-5-fluoropentanamide (PubChem CID 101292275) has the molecular formula C31H45FN2O4 and a molecular weight of 528.71 g/mol. Its IUPAC name is N-[2-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-hydroxyphenyl]-5-fluoropentanamide.
| Compound Name | N-[2-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-hydroxyphenyl]-5-fluoropentanamide |
|---|---|
| PubChem CID | 101292275 |
| Molecular Formula | C31H45FN2O4 |
| Molecular Weight | 528.71 g/mol |
| Exact Mass | 528.34 |
| IUPAC Name | N-[2-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-4-hydroxyphenyl]-5-fluoropentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1cc(O)ccc1NC(=O)CCCCF |
| InChI | InChI=1S/C31H45FN2O4/c1-8-26(38-27-17-14-21(30(4,5)9-2)19-23(27)31(6,7)10-3)29(37)34-25-20-22(35)15-16-24(25)33-28(36)13-11-12-18-32/h14-17,19-20,26,35H,8-13,18H2,1-7H3,(H,33,36)(H,34,37) |
| InChIKey | UJQKHGPRNYZGJA-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.71 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|