C31H38F8N2O4 — CID 23336930
N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-hydroxyphenyl]-2,2,3,3,4,4,5,5-octafluoropentanamide (PubChem CID 23336930) has the molecular formula C31H38F8N2O4 and a molecular weight of 654.64 g/mol. Its IUPAC name is N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-hydroxyphenyl]-2,2,3,3,4,4,5,5-octafluoropentanamide.
| Compound Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-hydroxyphenyl]-2,2,3,3,4,4,5,5-octafluoropentanamide |
|---|---|
| PubChem CID | 23336930 |
| Molecular Formula | C31H38F8N2O4 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.27 |
| IUPAC Name | N-[4-[2-[2,4-bis(2-methylbutan-2-yl)phenoxy]butanoylamino]-2-hydroxyphenyl]-2,2,3,3,4,4,5,5-octafluoropentanamide |
| SMILES | CCC(Oc1ccc(C(C)(C)CC)cc1C(C)(C)CC)C(=O)Nc1ccc(NC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)F)c(O)c1 |
| InChI | InChI=1S/C31H38F8N2O4/c1-8-22(45-23-14-11-17(27(4,5)9-2)15-19(23)28(6,7)10-3)24(43)40-18-12-13-20(21(42)16-18)41-26(44)30(36,37)31(38,39)29(34,35)25(32)33/h11-16,22,25,42H,8-10H2,1-7H3,(H,40,43)(H,41,44) |
| InChIKey | HJFJCERCFVOKRI-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|